C11H25FN2 — CID 81106048
N-(3-fluoropropyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 81106048) has the molecular formula C11H25FN2 and a molecular weight of 204.33 g/mol. Its IUPAC name is N-(3-fluoropropyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(3-fluoropropyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 81106048 |
| Molecular Formula | C11H25FN2 |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.20 |
| IUPAC Name | N-(3-fluoropropyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNCCCF)C(C)C |
| InChI | InChI=1S/C11H25FN2/c1-10(2)14(11(3)4)9-8-13-7-5-6-12/h10-11,13H,5-9H2,1-4H3 |
| InChIKey | SSVWKJJHNYHPKM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|