C9H24N2OSi — CID 123361702
N',N'-di(propan-2-yl)-N-(silyloxymethyl)ethane-1,2-diamine (PubChem CID 123361702) has the molecular formula C9H24N2OSi and a molecular weight of 204.39 g/mol. Its IUPAC name is N',N'-di(propan-2-yl)-N-(silyloxymethyl)ethane-1,2-diamine.
| Compound Name | N',N'-di(propan-2-yl)-N-(silyloxymethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 123361702 |
| Molecular Formula | C9H24N2OSi |
| Molecular Weight | 204.39 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | N',N'-di(propan-2-yl)-N-(silyloxymethyl)ethane-1,2-diamine |
| SMILES | CC(C)N(CCNCO[SiH3])C(C)C |
| InChI | InChI=1S/C9H24N2OSi/c1-8(2)11(9(3)4)6-5-10-7-12-13/h8-10H,5-7H2,1-4,13H3 |
| InChIKey | CALWDCOUHDBKKT-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|