C9H11F3N2O2 — CID 115514373
5-methyl-1-(4,4,4-trifluorobutyl)pyrazole-4-carboxylic acid (PubChem CID 115514373) has the molecular formula C9H11F3N2O2 and a molecular weight of 236.19 g/mol. Its IUPAC name is 5-methyl-1-(4,4,4-trifluorobutyl)pyrazole-4-carboxylic acid.
| Compound Name | 5-methyl-1-(4,4,4-trifluorobutyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115514373 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-methyl-1-(4,4,4-trifluorobutyl)pyrazole-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cnn1CCCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O2/c1-6-7(8(15)16)5-13-14(6)4-2-3-9(10,11)12/h5H,2-4H2,1H3,(H,15,16) |
| InChIKey | WKPPQMAPJPCXMH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |