C14H23F2NO3S — CID 11551553
3-amino-4-[(3S,5R)-4,4-difluoro-1-adamantyl]butane-1-sulfonic acid (PubChem CID 11551553) has the molecular formula C14H23F2NO3S and a molecular weight of 323.41 g/mol. Its IUPAC name is 3-amino-4-[(3S,5R)-4,4-difluoro-1-adamantyl]butane-1-sulfonic acid.
| Compound Name | 3-amino-4-[(3S,5R)-4,4-difluoro-1-adamantyl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 11551553 |
| Molecular Formula | C14H23F2NO3S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-amino-4-[(3S,5R)-4,4-difluoro-1-adamantyl]butane-1-sulfonic acid |
| SMILES | NC(CCS(=O)(=O)O)CC12CC3C[C@H](C1)C(F)(F)[C@@H](C3)C2 |
| InChI | InChI=1S/C14H23F2NO3S/c15-14(16)10-3-9-4-11(14)7-13(5-9,6-10)8-12(17)1-2-21(18,19)20/h9-12H,1-8,17H2,(H,18,19,20)/t9?,10-,11+,12?,13? |
| InChIKey | FNFWNHQRRFKPJX-FMNWTUGISA-N |
| XLogP | 2.44 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|