C10H15F3N2O — CID 115515644
1-(1,5-dimethylpyrazol-4-yl)-5,5,5-trifluoropentan-1-ol (PubChem CID 115515644) has the molecular formula C10H15F3N2O and a molecular weight of 236.24 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-4-yl)-5,5,5-trifluoropentan-1-ol.
| Compound Name | 1-(1,5-dimethylpyrazol-4-yl)-5,5,5-trifluoropentan-1-ol |
|---|---|
| PubChem CID | 115515644 |
| Molecular Formula | C10H15F3N2O |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-4-yl)-5,5,5-trifluoropentan-1-ol |
| SMILES | Cc1c(C(O)CCCC(F)(F)F)cnn1C |
| InChI | InChI=1S/C10H15F3N2O/c1-7-8(6-14-15(7)2)9(16)4-3-5-10(11,12)13/h6,9,16H,3-5H2,1-2H3 |
| InChIKey | IQALRDADBQIECP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |