C13H26F3NS — CID 115516904
1-butan-2-ylsulfanyl-6,6,6-trifluoro-N-propylhexan-2-amine (PubChem CID 115516904) has the molecular formula C13H26F3NS and a molecular weight of 285.42 g/mol. Its IUPAC name is 1-butan-2-ylsulfanyl-6,6,6-trifluoro-N-propylhexan-2-amine.
| Compound Name | 1-butan-2-ylsulfanyl-6,6,6-trifluoro-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 115516904 |
| Molecular Formula | C13H26F3NS |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-butan-2-ylsulfanyl-6,6,6-trifluoro-N-propylhexan-2-amine |
| SMILES | CCCNC(CCCC(F)(F)F)CSC(C)CC |
| InChI | InChI=1S/C13H26F3NS/c1-4-9-17-12(10-18-11(3)5-2)7-6-8-13(14,15)16/h11-12,17H,4-10H2,1-3H3 |
| InChIKey | YSJUDYQCXJLATB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |