C20H15NO4 — CID 11551711
(1S,10S,11S)-11-methyl-13-(4-methylphenyl)-3-oxa-13-azatetracyclo[8.4.0.01,11.04,9]tetradeca-4,6,8-triene-2,12,14-trione (PubChem CID 11551711) has the molecular formula C20H15NO4 and a molecular weight of 333.34 g/mol. Its IUPAC name is (1S,10S,11S)-11-methyl-13-(4-methylphenyl)-3-oxa-13-azatetracyclo[8.4.0.01,11.04,9]tetradeca-4,6,8-triene-2,12,14-trione.
| Compound Name | (1S,10S,11S)-11-methyl-13-(4-methylphenyl)-3-oxa-13-azatetracyclo[8.4.0.01,11.04,9]tetradeca-4,6,8-triene-2,12,14-trione |
|---|---|
| PubChem CID | 11551711 |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (1S,10S,11S)-11-methyl-13-(4-methylphenyl)-3-oxa-13-azatetracyclo[8.4.0.01,11.04,9]tetradeca-4,6,8-triene-2,12,14-trione |
| SMILES | Cc1ccc(N2C(=O)[C@]34C(=O)Oc5ccccc5[C@H]3[C@]4(C)C2=O)cc1 |
| InChI | InChI=1S/C20H15NO4/c1-11-7-9-12(10-8-11)21-16(22)19(2)15-13-5-3-4-6-14(13)25-18(24)20(15,19)17(21)23/h3-10,15H,1-2H3/t15-,19+,20-/m0/s1 |
| InChIKey | FGEMHFMOURFAGD-BEVDRBHNSA-N |
| XLogP | 2.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|