C22H20O4 — CID 98358706
(1R,1aR,7bS)-1a-acetyl-1-ethyl-1-(4-methylbenzoyl)-7bH-cyclopropa[c]chromen-2-one (PubChem CID 98358706) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (1R,1aR,7bS)-1a-acetyl-1-ethyl-1-(4-methylbenzoyl)-7bH-cyclopropa[c]chromen-2-one.
| Compound Name | (1R,1aR,7bS)-1a-acetyl-1-ethyl-1-(4-methylbenzoyl)-7bH-cyclopropa[c]chromen-2-one |
|---|---|
| PubChem CID | 98358706 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (1R,1aR,7bS)-1a-acetyl-1-ethyl-1-(4-methylbenzoyl)-7bH-cyclopropa[c]chromen-2-one |
| SMILES | CC[C@@]1(C(=O)c2ccc(C)cc2)[C@@H]2c3ccccc3OC(=O)[C@]21C(C)=O |
| InChI | InChI=1S/C22H20O4/c1-4-21(19(24)15-11-9-13(2)10-12-15)18-16-7-5-6-8-17(16)26-20(25)22(18,21)14(3)23/h5-12,18H,4H2,1-3H3/t18-,21-,22-/m0/s1 |
| InChIKey | UXUUFNQGFRUVLE-NYVOZVTQSA-N |
| XLogP | 3.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|