C26H27NO4 — CID 98067543
(1R,1aS,7bR)-1-benzoyl-N-cyclohexyl-1-ethyl-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxamide (PubChem CID 98067543) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (1R,1aS,7bR)-1-benzoyl-N-cyclohexyl-1-ethyl-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxamide.
| Compound Name | (1R,1aS,7bR)-1-benzoyl-N-cyclohexyl-1-ethyl-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxamide |
|---|---|
| PubChem CID | 98067543 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (1R,1aS,7bR)-1-benzoyl-N-cyclohexyl-1-ethyl-2-oxo-7bH-cyclopropa[c]chromene-1a-carboxamide |
| SMILES | CC[C@@]1(C(=O)c2ccccc2)[C@H]2c3ccccc3OC(=O)[C@@]21C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C26H27NO4/c1-2-25(22(28)17-11-5-3-6-12-17)21-19-15-9-10-16-20(19)31-24(30)26(21,25)23(29)27-18-13-7-4-8-14-18/h3,5-6,9-12,15-16,18,21H,2,4,7-8,13-14H2,1H3,(H,27,29)/t21-,25+,26+/m1/s1 |
| InChIKey | WBOUPZUKBFOFPB-NYMACZPPSA-N |
| XLogP | 4.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|