C24H22ClNO4 — CID 98067536
(1R,1aS,7bR)-1-(4-chlorobenzoyl)-1-methyl-1a-(piperidine-1-carbonyl)-7bH-cyclopropa[c]chromen-2-one (PubChem CID 98067536) has the molecular formula C24H22ClNO4 and a molecular weight of 423.90 g/mol. Its IUPAC name is (1R,1aS,7bR)-1-(4-chlorobenzoyl)-1-methyl-1a-(piperidine-1-carbonyl)-7bH-cyclopropa[c]chromen-2-one.
| Compound Name | (1R,1aS,7bR)-1-(4-chlorobenzoyl)-1-methyl-1a-(piperidine-1-carbonyl)-7bH-cyclopropa[c]chromen-2-one |
|---|---|
| PubChem CID | 98067536 |
| Molecular Formula | C24H22ClNO4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (1R,1aS,7bR)-1-(4-chlorobenzoyl)-1-methyl-1a-(piperidine-1-carbonyl)-7bH-cyclopropa[c]chromen-2-one |
| SMILES | C[C@@]1(C(=O)c2ccc(Cl)cc2)[C@H]2c3ccccc3OC(=O)[C@@]21C(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H22ClNO4/c1-23(20(27)15-9-11-16(25)12-10-15)19-17-7-3-4-8-18(17)30-22(29)24(19,23)21(28)26-13-5-2-6-14-26/h3-4,7-12,19H,2,5-6,13-14H2,1H3/t19-,23+,24+/m1/s1 |
| InChIKey | ZNMNWHDJTRAREX-YGOYIFOWSA-N |
| XLogP | 4.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|