C16H32NO4P — CID 11551713
tert-butyl N-[(1S,3S)-3-[butyl(ethoxy)phosphoryl]cyclopentyl]carbamate (PubChem CID 11551713) has the molecular formula C16H32NO4P and a molecular weight of 333.41 g/mol. Its IUPAC name is tert-butyl N-[(1S,3S)-3-[butyl(ethoxy)phosphoryl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3S)-3-[butyl(ethoxy)phosphoryl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 11551713 |
| Molecular Formula | C16H32NO4P |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | tert-butyl N-[(1S,3S)-3-[butyl(ethoxy)phosphoryl]cyclopentyl]carbamate |
| SMILES | CCCCP(=O)(OCC)[C@H]1CC[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H32NO4P/c1-6-8-11-22(19,20-7-2)14-10-9-13(12-14)17-15(18)21-16(3,4)5/h13-14H,6-12H2,1-5H3,(H,17,18)/t13-,14-,22?/m0/s1 |
| InChIKey | MJYDBYNJMPFVFH-LYXHXKSRSA-N |
| XLogP | 4.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|