C14H27NO4P- — CID 22281228
butyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]phosphinate (PubChem CID 22281228) has the molecular formula C14H27NO4P- and a molecular weight of 304.35 g/mol. Its IUPAC name is butyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]phosphinate.
| Compound Name | butyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]phosphinate |
|---|---|
| PubChem CID | 22281228 |
| Molecular Formula | C14H27NO4P- |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | butyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]phosphinate |
| SMILES | CCCCP(=O)([O-])C1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28NO4P/c1-5-6-9-20(17,18)12-8-7-11(10-12)15-13(16)19-14(2,3)4/h11-12H,5-10H2,1-4H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | DDMRILOAZWGMON-UHFFFAOYSA-M |
| XLogP | 2.87 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|