C16H31F3N2 — CID 115517230
N,3-diethyl-8,8,8-trifluoro-3-pyrrolidin-1-yloctan-4-amine (PubChem CID 115517230) has the molecular formula C16H31F3N2 and a molecular weight of 308.43 g/mol. Its IUPAC name is N,3-diethyl-8,8,8-trifluoro-3-pyrrolidin-1-yloctan-4-amine.
| Compound Name | N,3-diethyl-8,8,8-trifluoro-3-pyrrolidin-1-yloctan-4-amine |
|---|---|
| PubChem CID | 115517230 |
| Molecular Formula | C16H31F3N2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | N,3-diethyl-8,8,8-trifluoro-3-pyrrolidin-1-yloctan-4-amine |
| SMILES | CCNC(CCCC(F)(F)F)C(CC)(CC)N1CCCC1 |
| InChI | InChI=1S/C16H31F3N2/c1-4-15(5-2,21-12-7-8-13-21)14(20-6-3)10-9-11-16(17,18)19/h14,20H,4-13H2,1-3H3 |
| InChIKey | ISSLLRMZRCTKCJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |