C13H24F3NO — CID 79067574
5-ethyl-1,1,1-trifluoro-5-pyrrolidin-1-ylheptan-4-ol (PubChem CID 79067574) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-ethyl-1,1,1-trifluoro-5-pyrrolidin-1-ylheptan-4-ol.
| Compound Name | 5-ethyl-1,1,1-trifluoro-5-pyrrolidin-1-ylheptan-4-ol |
|---|---|
| PubChem CID | 79067574 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 5-ethyl-1,1,1-trifluoro-5-pyrrolidin-1-ylheptan-4-ol |
| SMILES | CCC(CC)(C(O)CCC(F)(F)F)N1CCCC1 |
| InChI | InChI=1S/C13H24F3NO/c1-3-12(4-2,17-9-5-6-10-17)11(18)7-8-13(14,15)16/h11,18H,3-10H2,1-2H3 |
| InChIKey | MDFFCAXZCQGULY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |