C13H23F3N2O — CID 115519309
2-[1-(methylamino)cyclohexyl]-N-(4,4,4-trifluorobutyl)acetamide (PubChem CID 115519309) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-[1-(methylamino)cyclohexyl]-N-(4,4,4-trifluorobutyl)acetamide.
| Compound Name | 2-[1-(methylamino)cyclohexyl]-N-(4,4,4-trifluorobutyl)acetamide |
|---|---|
| PubChem CID | 115519309 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-[1-(methylamino)cyclohexyl]-N-(4,4,4-trifluorobutyl)acetamide |
| SMILES | CNC1(CC(=O)NCCCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C13H23F3N2O/c1-17-12(6-3-2-4-7-12)10-11(19)18-9-5-8-13(14,15)16/h17H,2-10H2,1H3,(H,18,19) |
| InChIKey | NJUDWCRQMVLPBN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|