C14H19F3N2O2 — CID 115519416
3,6-dicyclopropyl-1-(4,4,4-trifluorobutyl)piperazine-2,5-dione (PubChem CID 115519416) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3,6-dicyclopropyl-1-(4,4,4-trifluorobutyl)piperazine-2,5-dione.
| Compound Name | 3,6-dicyclopropyl-1-(4,4,4-trifluorobutyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 115519416 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3,6-dicyclopropyl-1-(4,4,4-trifluorobutyl)piperazine-2,5-dione |
| SMILES | O=C1NC(C2CC2)C(=O)N(CCCC(F)(F)F)C1C1CC1 |
| InChI | InChI=1S/C14H19F3N2O2/c15-14(16,17)6-1-7-19-11(9-4-5-9)12(20)18-10(13(19)21)8-2-3-8/h8-11H,1-7H2,(H,18,20) |
| InChIKey | QATRMKCHBSVEDB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |