C11H16F3NO — CID 115522404
N-(4,4,4-trifluorobutyl)bicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 115522404) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutyl)bicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-(4,4,4-trifluorobutyl)bicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 115522404 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(4,4,4-trifluorobutyl)bicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | O=C(NCCCC(F)(F)F)C1CC2CC2C1 |
| InChI | InChI=1S/C11H16F3NO/c12-11(13,14)2-1-3-15-10(16)9-5-7-4-8(7)6-9/h7-9H,1-6H2,(H,15,16) |
| InChIKey | LCZOIKNHISSWGI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|