C9H11F3N2O2S — CID 115522984
3-methyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-carboxylic acid (PubChem CID 115522984) has the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. Its IUPAC name is 3-methyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-methyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115522984 |
| Molecular Formula | C9H11F3N2O2S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-methyl-5-(4,4,4-trifluorobutylamino)-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(NCCCC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C9H11F3N2O2S/c1-5-6(8(15)16)7(17-14-5)13-4-2-3-9(10,11)12/h13H,2-4H2,1H3,(H,15,16) |
| InChIKey | REBBFEZYESABCZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|