C10H13F3N2O2S — CID 115522987
3-methyl-5-(5,5,5-trifluoropentylamino)-1,2-thiazole-4-carboxylic acid (PubChem CID 115522987) has the molecular formula C10H13F3N2O2S and a molecular weight of 282.29 g/mol. Its IUPAC name is 3-methyl-5-(5,5,5-trifluoropentylamino)-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-methyl-5-(5,5,5-trifluoropentylamino)-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115522987 |
| Molecular Formula | C10H13F3N2O2S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-methyl-5-(5,5,5-trifluoropentylamino)-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(NCCCCC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C10H13F3N2O2S/c1-6-7(9(16)17)8(18-15-6)14-5-3-2-4-10(11,12)13/h14H,2-5H2,1H3,(H,16,17) |
| InChIKey | YJDYPSUDDNQWIC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|