C11H13F3N2O3 — CID 115523017
5-acetyl-3-(5,5,5-trifluoropentyl)-1H-pyrimidine-2,4-dione (PubChem CID 115523017) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 5-acetyl-3-(5,5,5-trifluoropentyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-acetyl-3-(5,5,5-trifluoropentyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115523017 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 5-acetyl-3-(5,5,5-trifluoropentyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)c1c[nH]c(=O)n(CCCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H13F3N2O3/c1-7(17)8-6-15-10(19)16(9(8)18)5-3-2-4-11(12,13)14/h6H,2-5H2,1H3,(H,15,19) |
| InChIKey | PDWFLPWVQXEXKC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|