C12H19F3N4 — CID 115523174
2-N-propyl-4-N-(5,5,5-trifluoropentyl)pyrimidine-2,4-diamine (PubChem CID 115523174) has the molecular formula C12H19F3N4 and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-N-propyl-4-N-(5,5,5-trifluoropentyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-propyl-4-N-(5,5,5-trifluoropentyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 115523174 |
| Molecular Formula | C12H19F3N4 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-N-propyl-4-N-(5,5,5-trifluoropentyl)pyrimidine-2,4-diamine |
| SMILES | CCCNc1nccc(NCCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H19F3N4/c1-2-7-17-11-18-9-5-10(19-11)16-8-4-3-6-12(13,14)15/h5,9H,2-4,6-8H2,1H3,(H2,16,17,18,19) |
| InChIKey | HSDKHIDGWDLEQJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|