C22H17F2NO3 — CID 11552658
methyl 3-[4-[(2,6-difluorobenzoyl)amino]phenyl]-4-methylbenzoate (PubChem CID 11552658) has the molecular formula C22H17F2NO3 and a molecular weight of 381.38 g/mol. Its IUPAC name is methyl 3-[4-[(2,6-difluorobenzoyl)amino]phenyl]-4-methylbenzoate.
| Compound Name | methyl 3-[4-[(2,6-difluorobenzoyl)amino]phenyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 11552658 |
| Molecular Formula | C22H17F2NO3 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | methyl 3-[4-[(2,6-difluorobenzoyl)amino]phenyl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(-c2ccc(NC(=O)c3c(F)cccc3F)cc2)c1 |
| InChI | InChI=1S/C22H17F2NO3/c1-13-6-7-15(22(27)28-2)12-17(13)14-8-10-16(11-9-14)25-21(26)20-18(23)4-3-5-19(20)24/h3-12H,1-2H3,(H,25,26) |
| InChIKey | JKAOBMCPBFAEQR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |