C11H7F2NO3 — CID 115527352
3-[3-(difluoromethyl)phenyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 115527352) has the molecular formula C11H7F2NO3 and a molecular weight of 239.18 g/mol. Its IUPAC name is 3-[3-(difluoromethyl)phenyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[3-(difluoromethyl)phenyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115527352 |
| Molecular Formula | C11H7F2NO3 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 3-[3-(difluoromethyl)phenyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccc(C(F)F)c2)no1 |
| InChI | InChI=1S/C11H7F2NO3/c12-10(13)7-3-1-2-6(4-7)8-5-9(11(15)16)17-14-8/h1-5,10H,(H,15,16) |
| InChIKey | YCNGVNLQVIBELW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |