C18H10ClF6N — CID 11552849
3-(4-chlorophenyl)-4-(1,1,2,2,3,3-hexafluoropropyl)isoquinoline (PubChem CID 11552849) has the molecular formula C18H10ClF6N and a molecular weight of 389.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(1,1,2,2,3,3-hexafluoropropyl)isoquinoline.
| Compound Name | 3-(4-chlorophenyl)-4-(1,1,2,2,3,3-hexafluoropropyl)isoquinoline |
|---|---|
| PubChem CID | 11552849 |
| Molecular Formula | C18H10ClF6N |
| Molecular Weight | 389.73 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(1,1,2,2,3,3-hexafluoropropyl)isoquinoline |
| SMILES | FC(F)C(F)(F)C(F)(F)c1c(-c2ccc(Cl)cc2)ncc2ccccc12 |
| InChI | InChI=1S/C18H10ClF6N/c19-12-7-5-10(6-8-12)15-14(17(22,23)18(24,25)16(20)21)13-4-2-1-3-11(13)9-26-15/h1-9,16H |
| InChIKey | HYLLUABGDIJCOV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.73 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|