C14H13N5O5S2 — CID 11552975
[3-[2-[[4-(4-amino-1,2,5-oxadiazol-3-yl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]phenyl] methanesulfonate (PubChem CID 11552975) has the molecular formula C14H13N5O5S2 and a molecular weight of 395.42 g/mol. Its IUPAC name is [3-[2-[[4-(4-amino-1,2,5-oxadiazol-3-yl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]phenyl] methanesulfonate.
| Compound Name | [3-[2-[[4-(4-amino-1,2,5-oxadiazol-3-yl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 11552975 |
| Molecular Formula | C14H13N5O5S2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | [3-[2-[[4-(4-amino-1,2,5-oxadiazol-3-yl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cccc(CC(=O)Nc2nc(-c3nonc3N)cs2)c1 |
| InChI | InChI=1S/C14H13N5O5S2/c1-26(21,22)23-9-4-2-3-8(5-9)6-11(20)17-14-16-10(7-25-14)12-13(15)19-24-18-12/h2-5,7H,6H2,1H3,(H2,15,19)(H,16,17,20) |
| InChIKey | HKRWXAJUPYKTRA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 150.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|