C12H13NOS — CID 115532695
N-(cyclopropylmethyl)-N-prop-2-ynylthiophene-3-carboxamide (PubChem CID 115532695) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-prop-2-ynylthiophene-3-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-N-prop-2-ynylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 115532695 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N-(cyclopropylmethyl)-N-prop-2-ynylthiophene-3-carboxamide |
| SMILES | C#CCN(CC1CC1)C(=O)c1ccsc1 |
| InChI | InChI=1S/C12H13NOS/c1-2-6-13(8-10-3-4-10)12(14)11-5-7-15-9-11/h1,5,7,9-10H,3-4,6,8H2 |
| InChIKey | KPRJSRUCHDKFFB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|