C15H17NO3 — CID 115532759
N-(cyclopropylmethyl)-2-hydroxy-4-methoxy-N-prop-2-ynylbenzamide (PubChem CID 115532759) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-hydroxy-4-methoxy-N-prop-2-ynylbenzamide.
| Compound Name | N-(cyclopropylmethyl)-2-hydroxy-4-methoxy-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 115532759 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-(cyclopropylmethyl)-2-hydroxy-4-methoxy-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(CC1CC1)C(=O)c1ccc(OC)cc1O |
| InChI | InChI=1S/C15H17NO3/c1-3-8-16(10-11-4-5-11)15(18)13-7-6-12(19-2)9-14(13)17/h1,6-7,9,11,17H,4-5,8,10H2,2H3 |
| InChIKey | GRLQSGTURVAEMU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|