C16H16N2O3 — CID 115532769
(E)-N-(cyclopropylmethyl)-3-(3-nitrophenyl)-N-prop-2-ynylprop-2-enamide (PubChem CID 115532769) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is (E)-N-(cyclopropylmethyl)-3-(3-nitrophenyl)-N-prop-2-ynylprop-2-enamide.
| Compound Name | (E)-N-(cyclopropylmethyl)-3-(3-nitrophenyl)-N-prop-2-ynylprop-2-enamide |
|---|---|
| PubChem CID | 115532769 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (E)-N-(cyclopropylmethyl)-3-(3-nitrophenyl)-N-prop-2-ynylprop-2-enamide |
| SMILES | C#CCN(CC1CC1)C(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N2O3/c1-2-10-17(12-14-6-7-14)16(19)9-8-13-4-3-5-15(11-13)18(20)21/h1,3-5,8-9,11,14H,6-7,10,12H2/b9-8+ |
| InChIKey | SEIDMCUVAOGYTQ-CMDGGOBGSA-N |
| XLogP | 2.48 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|