C16H22N2O3 — CID 115533094
methyl 1-[3-(3-aminophenyl)propanoyl]piperidine-3-carboxylate (PubChem CID 115533094) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl 1-[3-(3-aminophenyl)propanoyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[3-(3-aminophenyl)propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 115533094 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | methyl 1-[3-(3-aminophenyl)propanoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)CCc2cccc(N)c2)C1 |
| InChI | InChI=1S/C16H22N2O3/c1-21-16(20)13-5-3-9-18(11-13)15(19)8-7-12-4-2-6-14(17)10-12/h2,4,6,10,13H,3,5,7-9,11,17H2,1H3 |
| InChIKey | XACZECAUATZCAA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|