C17H23NO3 — CID 78919193
methyl 1-[3-(4-methylphenyl)propanoyl]piperidine-3-carboxylate (PubChem CID 78919193) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is methyl 1-[3-(4-methylphenyl)propanoyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[3-(4-methylphenyl)propanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919193 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | methyl 1-[3-(4-methylphenyl)propanoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)CCc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C17H23NO3/c1-13-5-7-14(8-6-13)9-10-16(19)18-11-3-4-15(12-18)17(20)21-2/h5-8,15H,3-4,9-12H2,1-2H3 |
| InChIKey | TXUNTAQJAMZNQX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |