C17H23N3O — CID 115534345
3-[2-(2-ethoxyphenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine (PubChem CID 115534345) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[2-(2-ethoxyphenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine.
| Compound Name | 3-[2-(2-ethoxyphenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 115534345 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 3-[2-(2-ethoxyphenyl)-4,6-dimethylpyrimidin-5-yl]propan-1-amine |
| SMILES | CCOc1ccccc1-c1nc(C)c(CCCN)c(C)n1 |
| InChI | InChI=1S/C17H23N3O/c1-4-21-16-10-6-5-8-15(16)17-19-12(2)14(9-7-11-18)13(3)20-17/h5-6,8,10H,4,7,9,11,18H2,1-3H3 |
| InChIKey | WBHJTUYWJDADNB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |