C15H19N3O — CID 137013044
2-[5-(3-aminopropyl)-4,6-dimethylpyrimidin-2-yl]phenol (PubChem CID 137013044) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-[5-(3-aminopropyl)-4,6-dimethylpyrimidin-2-yl]phenol.
| Compound Name | 2-[5-(3-aminopropyl)-4,6-dimethylpyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 137013044 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-[5-(3-aminopropyl)-4,6-dimethylpyrimidin-2-yl]phenol |
| SMILES | Cc1nc(-c2ccccc2O)nc(C)c1CCCN |
| InChI | InChI=1S/C15H19N3O/c1-10-12(7-5-9-16)11(2)18-15(17-10)13-6-3-4-8-14(13)19/h3-4,6,8,19H,5,7,9,16H2,1-2H3 |
| InChIKey | ZZYNKYQYNHIBHI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |