C15H19ClN2O3 — CID 115536142
methyl (2R)-1-[(3-chloro-4-methylphenyl)carbamoyl]piperidine-2-carboxylate (PubChem CID 115536142) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is methyl (2R)-1-[(3-chloro-4-methylphenyl)carbamoyl]piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[(3-chloro-4-methylphenyl)carbamoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115536142 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | methyl (2R)-1-[(3-chloro-4-methylphenyl)carbamoyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-10-6-7-11(9-12(10)16)17-15(20)18-8-4-3-5-13(18)14(19)21-2/h6-7,9,13H,3-5,8H2,1-2H3,(H,17,20)/t13-/m1/s1 |
| InChIKey | JEZAFSAHCCIKQW-CYBMUJFWSA-N |
| XLogP | 3.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |