methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate

C10H15N3O4 — CID 115537740

IUPACmethyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate
SMILESCOC(=O)CC1CN(Cc2ncon2)CCO1
InChIInChI=1S/C10H15N3O4/c1-15-10(14)4-8-5-13(2-3-16-8)6-9-11-7-17-12-9/h7-8H,2-6H2,1H3
InChIKeyVFXLTTDWMLSNPV-UHFFFAOYSA-N
MW241.25 g/mol
LogP-0.17
Rot. Bonds4

About methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate

methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate (PubChem CID 115537740) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate
PubChem CID115537740
Molecular FormulaC10H15N3O4
Molecular Weight241.25 g/mol
Exact Mass241.11
IUPAC Namemethyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate
SMILESCOC(=O)CC1CN(Cc2ncon2)CCO1
InChIInChI=1S/C10H15N3O4/c1-15-10(14)4-8-5-13(2-3-16-8)6-9-11-7-17-12-9/h7-8H,2-6H2,1H3
InChIKeyVFXLTTDWMLSNPV-UHFFFAOYSA-N
XLogP-0.17
TPSA77.69 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 5-0.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate?
The IUPAC name of methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate (CID 115537740) is methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate.
What is the SMILES notation for methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate?
The canonical SMILES for methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate is COC(=O)CC1CN(Cc2ncon2)CCO1.
What is the InChIKey of methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate?
The InChIKey is VFXLTTDWMLSNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-15-10(14)4-8-5-13(2-3-16-8)6-9-11-7-17-12-9/h7-8H,2-6H2,1H3.
What are the key properties of methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate?
methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate has a molecular weight of 241.25 g/mol, XLogP of -0.17, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(1,2,4-oxadiazol-3-ylmethyl)morpholin-2-yl]acetate is sourced from PubChem (CID 115537740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).