C14H25NO3 — CID 115537818
methyl (2R)-1-(2-hydroxycycloheptyl)piperidine-2-carboxylate (PubChem CID 115537818) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is methyl (2R)-1-(2-hydroxycycloheptyl)piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(2-hydroxycycloheptyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115537818 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | methyl (2R)-1-(2-hydroxycycloheptyl)piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1C1CCCCCC1O |
| InChI | InChI=1S/C14H25NO3/c1-18-14(17)12-8-5-6-10-15(12)11-7-3-2-4-9-13(11)16/h11-13,16H,2-10H2,1H3/t11?,12-,13?/m1/s1 |
| InChIKey | NLVYZRUYGXMLRT-OTTFEQOBSA-N |
| XLogP | 1.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |