C15H27NO2 — CID 115537940
methyl (2R)-1-(4-ethylcyclohexyl)piperidine-2-carboxylate (PubChem CID 115537940) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is methyl (2R)-1-(4-ethylcyclohexyl)piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(4-ethylcyclohexyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115537940 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | methyl (2R)-1-(4-ethylcyclohexyl)piperidine-2-carboxylate |
| SMILES | CCC1CCC(N2CCCC[C@@H]2C(=O)OC)CC1 |
| InChI | InChI=1S/C15H27NO2/c1-3-12-7-9-13(10-8-12)16-11-5-4-6-14(16)15(17)18-2/h12-14H,3-11H2,1-2H3/t12?,13?,14-/m1/s1 |
| InChIKey | NRUDZIACAODQTP-JXQTWKCFSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |