C10H22Cl2N2Pt — CID 11553875
4-tert-butylcyclohexane-1,2-diamine;dichloroplatinum (PubChem CID 11553875) has the molecular formula C10H22Cl2N2Pt and a molecular weight of 436.28 g/mol. Its IUPAC name is 4-tert-butylcyclohexane-1,2-diamine;dichloroplatinum.
| Compound Name | 4-tert-butylcyclohexane-1,2-diamine;dichloroplatinum |
|---|---|
| PubChem CID | 11553875 |
| Molecular Formula | C10H22Cl2N2Pt |
| Molecular Weight | 436.28 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 4-tert-butylcyclohexane-1,2-diamine;dichloroplatinum |
| SMILES | CC(C)(C)C1CCC(N)C(N)C1.Cl[Pt]Cl |
| InChI | InChI=1S/C10H22N2.2ClH.Pt/c1-10(2,3)7-4-5-8(11)9(12)6-7;;;/h7-9H,4-6,11-12H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | AYNCELZNGKANTM-UHFFFAOYSA-L |
| XLogP | 2.86 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |