C12H19N3O2 — CID 115539077
ethyl 2-[2-imidazol-1-ylethyl(prop-2-enyl)amino]acetate (PubChem CID 115539077) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is ethyl 2-[2-imidazol-1-ylethyl(prop-2-enyl)amino]acetate.
| Compound Name | ethyl 2-[2-imidazol-1-ylethyl(prop-2-enyl)amino]acetate |
|---|---|
| PubChem CID | 115539077 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | ethyl 2-[2-imidazol-1-ylethyl(prop-2-enyl)amino]acetate |
| SMILES | C=CCN(CCn1ccnc1)CC(=O)OCC |
| InChI | InChI=1S/C12H19N3O2/c1-3-6-14(10-12(16)17-4-2)8-9-15-7-5-13-11-15/h3,5,7,11H,1,4,6,8-10H2,2H3 |
| InChIKey | XMACOHRAGUZRCQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|