C11H21NO4 — CID 115539187
ethyl 2-[2,2-dimethoxyethyl(prop-2-enyl)amino]acetate (PubChem CID 115539187) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is ethyl 2-[2,2-dimethoxyethyl(prop-2-enyl)amino]acetate.
| Compound Name | ethyl 2-[2,2-dimethoxyethyl(prop-2-enyl)amino]acetate |
|---|---|
| PubChem CID | 115539187 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | ethyl 2-[2,2-dimethoxyethyl(prop-2-enyl)amino]acetate |
| SMILES | C=CCN(CC(=O)OCC)CC(OC)OC |
| InChI | InChI=1S/C11H21NO4/c1-5-7-12(8-10(13)16-6-2)9-11(14-3)15-4/h5,11H,1,6-9H2,2-4H3 |
| InChIKey | GEIZNTISWLOLHT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|