C26H29F3N2O — CID 11554037
3-ethyl-3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indol-2-one (PubChem CID 11554037) has the molecular formula C26H29F3N2O and a molecular weight of 442.53 g/mol. Its IUPAC name is 3-ethyl-3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indol-2-one.
| Compound Name | 3-ethyl-3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 11554037 |
| Molecular Formula | C26H29F3N2O |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 3-ethyl-3-[4-[4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butyl]-1H-indol-2-one |
| SMILES | CCC1(CCCCN2CC=C(c3cccc(C(F)(F)F)c3)CC2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C26H29F3N2O/c1-2-25(22-10-3-4-11-23(22)30-24(25)32)14-5-6-15-31-16-12-19(13-17-31)20-8-7-9-21(18-20)26(27,28)29/h3-4,7-12,18H,2,5-6,13-17H2,1H3,(H,30,32) |
| InChIKey | XCIVJSFHJITCRC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|