C12H13N3O5 — CID 115542394
2-nitro-3-[(2-oxopiperidin-3-yl)amino]benzoic acid (PubChem CID 115542394) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is 2-nitro-3-[(2-oxopiperidin-3-yl)amino]benzoic acid.
| Compound Name | 2-nitro-3-[(2-oxopiperidin-3-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 115542394 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-nitro-3-[(2-oxopiperidin-3-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC2CCCNC2=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O5/c16-11-9(5-2-6-13-11)14-8-4-1-3-7(12(17)18)10(8)15(19)20/h1,3-4,9,14H,2,5-6H2,(H,13,16)(H,17,18) |
| InChIKey | VKHWCWYTYPGEQX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|