C12H16N4O2 — CID 112578755
3-amino-2-[(2-oxopiperidin-3-yl)amino]benzamide (PubChem CID 112578755) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-amino-2-[(2-oxopiperidin-3-yl)amino]benzamide.
| Compound Name | 3-amino-2-[(2-oxopiperidin-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 112578755 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-amino-2-[(2-oxopiperidin-3-yl)amino]benzamide |
| SMILES | NC(=O)c1cccc(N)c1NC1CCCNC1=O |
| InChI | InChI=1S/C12H16N4O2/c13-8-4-1-3-7(11(14)17)10(8)16-9-5-2-6-15-12(9)18/h1,3-4,9,16H,2,5-6,13H2,(H2,14,17)(H,15,18) |
| InChIKey | MPSHLNJNYOCQEH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|