C22H21F5O4S — CID 11554714
2-[3-(2,5-difluorophenyl)-3-[4-(trifluoromethyl)phenyl]sulfonylhex-5-enyl]-1,3-dioxolane (PubChem CID 11554714) has the molecular formula C22H21F5O4S and a molecular weight of 476.46 g/mol. Its IUPAC name is 2-[3-(2,5-difluorophenyl)-3-[4-(trifluoromethyl)phenyl]sulfonylhex-5-enyl]-1,3-dioxolane.
| Compound Name | 2-[3-(2,5-difluorophenyl)-3-[4-(trifluoromethyl)phenyl]sulfonylhex-5-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 11554714 |
| Molecular Formula | C22H21F5O4S |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[3-(2,5-difluorophenyl)-3-[4-(trifluoromethyl)phenyl]sulfonylhex-5-enyl]-1,3-dioxolane |
| SMILES | C=CCC(CCC1OCCO1)(c1cc(F)ccc1F)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H21F5O4S/c1-2-10-21(11-9-20-30-12-13-31-20,18-14-16(23)5-8-19(18)24)32(28,29)17-6-3-15(4-7-17)22(25,26)27/h2-8,14,20H,1,9-13H2 |
| InChIKey | BSUUXEGVKHELIF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|