C14H11F2NO2S — CID 115547521
methyl 2-amino-3-(2,5-difluorophenyl)sulfanylbenzoate (PubChem CID 115547521) has the molecular formula C14H11F2NO2S and a molecular weight of 295.31 g/mol. Its IUPAC name is methyl 2-amino-3-(2,5-difluorophenyl)sulfanylbenzoate.
| Compound Name | methyl 2-amino-3-(2,5-difluorophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 115547521 |
| Molecular Formula | C14H11F2NO2S |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | methyl 2-amino-3-(2,5-difluorophenyl)sulfanylbenzoate |
| SMILES | COC(=O)c1cccc(Sc2cc(F)ccc2F)c1N |
| InChI | InChI=1S/C14H11F2NO2S/c1-19-14(18)9-3-2-4-11(13(9)17)20-12-7-8(15)5-6-10(12)16/h2-7H,17H2,1H3 |
| InChIKey | JNCHSUHSJLTMSD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|