C17H25ClN2 — CID 115553265
2-(chloromethyl)-7-methyl-1-(2,4,4-trimethylpentan-2-yl)benzimidazole (PubChem CID 115553265) has the molecular formula C17H25ClN2 and a molecular weight of 292.85 g/mol. Its IUPAC name is 2-(chloromethyl)-7-methyl-1-(2,4,4-trimethylpentan-2-yl)benzimidazole.
| Compound Name | 2-(chloromethyl)-7-methyl-1-(2,4,4-trimethylpentan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 115553265 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-(chloromethyl)-7-methyl-1-(2,4,4-trimethylpentan-2-yl)benzimidazole |
| SMILES | Cc1cccc2nc(CCl)n(C(C)(C)CC(C)(C)C)c12 |
| InChI | InChI=1S/C17H25ClN2/c1-12-8-7-9-13-15(12)20(14(10-18)19-13)17(5,6)11-16(2,3)4/h7-9H,10-11H2,1-6H3 |
| InChIKey | RDLPLFXEQDQYMF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|