C13H19N3O3 — CID 115553948
N,2-dimethyl-N-(morpholin-2-ylmethyl)-6-nitroaniline (PubChem CID 115553948) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N,2-dimethyl-N-(morpholin-2-ylmethyl)-6-nitroaniline.
| Compound Name | N,2-dimethyl-N-(morpholin-2-ylmethyl)-6-nitroaniline |
|---|---|
| PubChem CID | 115553948 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N,2-dimethyl-N-(morpholin-2-ylmethyl)-6-nitroaniline |
| SMILES | Cc1cccc([N+](=O)[O-])c1N(C)CC1CNCCO1 |
| InChI | InChI=1S/C13H19N3O3/c1-10-4-3-5-12(16(17)18)13(10)15(2)9-11-8-14-6-7-19-11/h3-5,11,14H,6-9H2,1-2H3 |
| InChIKey | NCIMRTBDERPWNO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|