C17H19ClN2 — CID 115554482
2-chloro-5-methyl-4-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzene-1,4-diamine (PubChem CID 115554482) has the molecular formula C17H19ClN2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 2-chloro-5-methyl-4-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzene-1,4-diamine.
| Compound Name | 2-chloro-5-methyl-4-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 115554482 |
| Molecular Formula | C17H19ClN2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-chloro-5-methyl-4-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzene-1,4-diamine |
| SMILES | Cc1cc(N)c(Cl)cc1Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C17H19ClN2/c1-11-9-15(19)14(18)10-17(11)20-16-8-4-6-12-5-2-3-7-13(12)16/h4,6,8-10,20H,2-3,5,7,19H2,1H3 |
| InChIKey | YHAYHHBRMYPJBW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|