C13H19ClN2 — CID 115554545
2-chloro-4-N-cyclopropyl-5-methyl-4-N-propylbenzene-1,4-diamine (PubChem CID 115554545) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is 2-chloro-4-N-cyclopropyl-5-methyl-4-N-propylbenzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-cyclopropyl-5-methyl-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 115554545 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-chloro-4-N-cyclopropyl-5-methyl-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCN(c1cc(Cl)c(N)cc1C)C1CC1 |
| InChI | InChI=1S/C13H19ClN2/c1-3-6-16(10-4-5-10)13-8-11(14)12(15)7-9(13)2/h7-8,10H,3-6,15H2,1-2H3 |
| InChIKey | WMARAHRKPNYDCF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|