C11H15Cl2N3 — CID 102755856
3,5-dichloro-6-N-cyclopropyl-6-N-propylpyridine-2,6-diamine (PubChem CID 102755856) has the molecular formula C11H15Cl2N3 and a molecular weight of 260.17 g/mol. Its IUPAC name is 3,5-dichloro-6-N-cyclopropyl-6-N-propylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-cyclopropyl-6-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102755856 |
| Molecular Formula | C11H15Cl2N3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 3,5-dichloro-6-N-cyclopropyl-6-N-propylpyridine-2,6-diamine |
| SMILES | CCCN(c1nc(N)c(Cl)cc1Cl)C1CC1 |
| InChI | InChI=1S/C11H15Cl2N3/c1-2-5-16(7-3-4-7)11-9(13)6-8(12)10(14)15-11/h6-7H,2-5H2,1H3,(H2,14,15) |
| InChIKey | BQRBFYCYLILBSG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |