C12H19N3 — CID 81133120
2-N-cyclopropyl-6-methyl-2-N-propylpyridine-2,3-diamine (PubChem CID 81133120) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 2-N-cyclopropyl-6-methyl-2-N-propylpyridine-2,3-diamine.
| Compound Name | 2-N-cyclopropyl-6-methyl-2-N-propylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 81133120 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 2-N-cyclopropyl-6-methyl-2-N-propylpyridine-2,3-diamine |
| SMILES | CCCN(c1nc(C)ccc1N)C1CC1 |
| InChI | InChI=1S/C12H19N3/c1-3-8-15(10-5-6-10)12-11(13)7-4-9(2)14-12/h4,7,10H,3,5-6,8,13H2,1-2H3 |
| InChIKey | QBLAINLWIZYZCV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |